About 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid
2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid (PubChem CID 150959935) has the molecular formula C7H9N3O4
and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid |
| PubChem CID | 150959935 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid |
| SMILES | NCc1[nH]c(=O)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C7H9N3O4/c8-2-4-3(1-5(11)12)6(13)10-7(14)9-4/h1-2,8H2,(H,11,12)(H2,9,10,13,14) |
| InChIKey | LLWPKTDSDUQBFY-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid?
The IUPAC name of 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid (CID 150959935) is 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid.
What is the SMILES notation for 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid?
The canonical SMILES for 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid is NCc1[nH]c(=O)[nH]c(=O)c1CC(=O)O.
What is the InChIKey of 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid?
The InChIKey is LLWPKTDSDUQBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4/c8-2-4-3(1-5(11)12)6(13)10-7(14)9-4/h1-2,8H2,(H,11,12)(H2,9,10,13,14).
What are the key properties of 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid?
2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid has a molecular weight of 199.17 g/mol, XLogP of -1.85, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(aminomethyl)-2,4-dioxo-1H-pyrimidin-5-yl]acetic acid is sourced from PubChem (CID 150959935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).