C16H18ClNO2 — CID 15096046
7-chloro-11-methyl-2-(prop-2-enoxymethyl)-3-oxa-11-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene (PubChem CID 15096046) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 7-chloro-11-methyl-2-(prop-2-enoxymethyl)-3-oxa-11-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene.
| Compound Name | 7-chloro-11-methyl-2-(prop-2-enoxymethyl)-3-oxa-11-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene |
|---|---|
| PubChem CID | 15096046 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 7-chloro-11-methyl-2-(prop-2-enoxymethyl)-3-oxa-11-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene |
| SMILES | C=CCOCc1oc2ccc(Cl)c3c2c1CN(C)CC3 |
| InChI | InChI=1S/C16H18ClNO2/c1-3-8-19-10-15-12-9-18(2)7-6-11-13(17)4-5-14(20-15)16(11)12/h3-5H,1,6-10H2,2H3 |
| InChIKey | CDCHUJVGZGJANH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|