About 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione
7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione (PubChem CID 15096107) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione.
Molecular Properties
| Compound Name | 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione |
| PubChem CID | 15096107 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione |
| SMILES | Cc1cccc2c(=O)c3cnccc3c(=O)[nH]c12 |
| InChI | InChI=1S/C14H10N2O2/c1-8-3-2-4-10-12(8)16-14(18)9-5-6-15-7-11(9)13(10)17/h2-7H,1H3,(H,16,18) |
| InChIKey | SVARNTPITHFBMJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione?
The IUPAC name of 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione (CID 15096107) is 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione.
What is the SMILES notation for 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione?
The canonical SMILES for 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione is Cc1cccc2c(=O)c3cnccc3c(=O)[nH]c12.
What is the InChIKey of 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione?
The InChIKey is SVARNTPITHFBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c1-8-3-2-4-10-12(8)16-14(18)9-5-6-15-7-11(9)13(10)17/h2-7H,1H3,(H,16,18).
What are the key properties of 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione?
7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione has a molecular weight of 238.25 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6H-pyrido[4,3-c][1]benzazepine-5,11-dione is sourced from PubChem (CID 15096107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).