C18H39N — CID 150961559
N,N,3-triethyldodecan-3-amine (PubChem CID 150961559) has the molecular formula C18H39N and a molecular weight of 269.52 g/mol. Its IUPAC name is N,N,3-triethyldodecan-3-amine.
| Compound Name | N,N,3-triethyldodecan-3-amine |
|---|---|
| PubChem CID | 150961559 |
| Molecular Formula | C18H39N |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 269.31 |
| IUPAC Name | N,N,3-triethyldodecan-3-amine |
| SMILES | CCCCCCCCCC(CC)(CC)N(CC)CC |
| InChI | InChI=1S/C18H39N/c1-6-11-12-13-14-15-16-17-18(7-2,8-3)19(9-4)10-5/h6-17H2,1-5H3 |
| InChIKey | LMEYWUVROUDSKJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|