About 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane
2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane (PubChem CID 15096575) has the molecular formula C10H8Cl4O
and a molecular weight of 285.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane |
| PubChem CID | 15096575 |
| Molecular Formula | C10H8Cl4O |
| Molecular Weight | 285.99 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane |
| SMILES | Clc1ccc(C2(CC(Cl)(Cl)Cl)CO2)cc1 |
| InChI | InChI=1S/C10H8Cl4O/c11-8-3-1-7(2-4-8)9(6-15-9)5-10(12,13)14/h1-4H,5-6H2 |
| InChIKey | KBVNUUKKWWOHCE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.99 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane?
The IUPAC name of 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane (CID 15096575) is 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane.
What is the SMILES notation for 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane?
The canonical SMILES for 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane is Clc1ccc(C2(CC(Cl)(Cl)Cl)CO2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane?
The InChIKey is KBVNUUKKWWOHCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl4O/c11-8-3-1-7(2-4-8)9(6-15-9)5-10(12,13)14/h1-4H,5-6H2.
What are the key properties of 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane?
2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane has a molecular weight of 285.99 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-2-(2,2,2-trichloroethyl)oxirane is sourced from PubChem (CID 15096575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).