C24H25F3N4O4S — CID 150966535
methyl (1S,3S,5R)-3-(phenylmethoxycarbonylamino)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexane-1-carboxylate (PubChem CID 150966535) has the molecular formula C24H25F3N4O4S and a molecular weight of 522.55 g/mol. Its IUPAC name is methyl (1S,3S,5R)-3-(phenylmethoxycarbonylamino)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3S,5R)-3-(phenylmethoxycarbonylamino)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 150966535 |
| Molecular Formula | C24H25F3N4O4S |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | methyl (1S,3S,5R)-3-(phenylmethoxycarbonylamino)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](NC(=O)OCc2ccccc2)C[C@H](Nc2ncnc3sc(CC(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C24H25F3N4O4S/c1-34-22(32)15-7-16(9-17(8-15)31-23(33)35-12-14-5-3-2-4-6-14)30-20-19-10-18(11-24(25,26)27)36-21(19)29-13-28-20/h2-6,10,13,15-17H,7-9,11-12H2,1H3,(H,31,33)(H,28,29,30)/t15-,16+,17-/m0/s1 |
| InChIKey | LNEXQQRGMHJEMW-BBWFWOEESA-N |
| XLogP | 4.84 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |