C4HF9O2 — CID 150967738
1,1,1,2,3,3-hexafluoro-3-(trifluoromethylperoxy)propane (PubChem CID 150967738) has the molecular formula C4HF9O2 and a molecular weight of 252.03 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(trifluoromethylperoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(trifluoromethylperoxy)propane |
|---|---|
| PubChem CID | 150967738 |
| Molecular Formula | C4HF9O2 |
| Molecular Weight | 252.03 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(trifluoromethylperoxy)propane |
| SMILES | FC(C(F)(F)F)C(F)(F)OOC(F)(F)F |
| InChI | InChI=1S/C4HF9O2/c5-1(2(6,7)8)3(9,10)14-15-4(11,12)13/h1H |
| InChIKey | LNLJLHSHHJJFBB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.03 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|