C18H12N2O — CID 150971270
4-(4-pyridin-3-ylphenyl)-1,3-benzoxazole (PubChem CID 150971270) has the molecular formula C18H12N2O and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-(4-pyridin-3-ylphenyl)-1,3-benzoxazole.
| Compound Name | 4-(4-pyridin-3-ylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 150971270 |
| Molecular Formula | C18H12N2O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-(4-pyridin-3-ylphenyl)-1,3-benzoxazole |
| SMILES | c1cncc(-c2ccc(-c3cccc4ocnc34)cc2)c1 |
| InChI | InChI=1S/C18H12N2O/c1-4-16(18-17(5-1)21-12-20-18)14-8-6-13(7-9-14)15-3-2-10-19-11-15/h1-12H |
| InChIKey | LODWWJWLTGVVSO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |