C11H11O7P — CID 150972159
(6-methoxy-1-benzofuran-2-carbonyl)oxymethylphosphonic acid (PubChem CID 150972159) has the molecular formula C11H11O7P and a molecular weight of 286.18 g/mol. Its IUPAC name is (6-methoxy-1-benzofuran-2-carbonyl)oxymethylphosphonic acid.
| Compound Name | (6-methoxy-1-benzofuran-2-carbonyl)oxymethylphosphonic acid |
|---|---|
| PubChem CID | 150972159 |
| Molecular Formula | C11H11O7P |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | (6-methoxy-1-benzofuran-2-carbonyl)oxymethylphosphonic acid |
| SMILES | COc1ccc2cc(C(=O)OCP(=O)(O)O)oc2c1 |
| InChI | InChI=1S/C11H11O7P/c1-16-8-3-2-7-4-10(18-9(7)5-8)11(12)17-6-19(13,14)15/h2-5H,6H2,1H3,(H2,13,14,15) |
| InChIKey | LOIHKMZAAYGFGR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|