About 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran
6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran (PubChem CID 15097265) has the molecular formula C24H42O6
and a molecular weight of 426.59 g/mol. Its IUPAC name is 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran |
| PubChem CID | 15097265 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran |
| SMILES | C1=C(COCC(CCCCCCOC2CCCCO2)OC2CCCCO2)OCCC1 |
| InChI | InChI=1S/C24H42O6/c1(2-7-16-27-23-13-5-9-17-28-23)3-12-22(30-24-14-6-10-18-29-24)20-25-19-21-11-4-8-15-26-21/h11,22-24H,1-10,12-20H2 |
| InChIKey | KXKOSTCZYYRWOT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran?
The IUPAC name of 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran (CID 15097265) is 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran is C1=C(COCC(CCCCCCOC2CCCCO2)OC2CCCCO2)OCCC1.
What is the InChIKey of 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran?
The InChIKey is KXKOSTCZYYRWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O6/c1(2-7-16-27-23-13-5-9-17-28-23)3-12-22(30-24-14-6-10-18-29-24)20-25-19-21-11-4-8-15-26-21/h11,22-24H,1-10,12-20H2.
What are the key properties of 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran?
6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran has a molecular weight of 426.59 g/mol, XLogP of 5.10, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2,8-bis(oxan-2-yloxy)octoxymethyl]-3,4-dihydro-2H-pyran is sourced from PubChem (CID 15097265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).