About 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile
2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile (PubChem CID 150973529) has the molecular formula C3F7N3
and a molecular weight of 211.04 g/mol. Its IUPAC name is 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile.
Molecular Properties
| Compound Name | 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile |
| PubChem CID | 150973529 |
| Molecular Formula | C3F7N3 |
| Molecular Weight | 211.04 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile |
| SMILES | N#CC(F)(N(F)F)C(F)(F)N(F)F |
| InChI | InChI=1S/C3F7N3/c4-2(1-11,12(7)8)3(5,6)13(9)10 |
| InChIKey | LOPXGVUMIXWZKM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.04 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile?
The IUPAC name of 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile (CID 150973529) is 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile.
What is the SMILES notation for 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile?
The canonical SMILES for 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile is N#CC(F)(N(F)F)C(F)(F)N(F)F.
What is the InChIKey of 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile?
The InChIKey is LOPXGVUMIXWZKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3F7N3/c4-2(1-11,12(7)8)3(5,6)13(9)10.
What are the key properties of 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile?
2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile has a molecular weight of 211.04 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(difluoroamino)-2,3,3-trifluoropropanenitrile is sourced from PubChem (CID 150973529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).