About 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid
1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid (PubChem CID 150976053) has the molecular formula C17H26N2O4S
and a molecular weight of 354.47 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid.
Molecular Properties
| Compound Name | 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid |
| PubChem CID | 150976053 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid |
| SMILES | CC(c1ccc2c(c1)C(C)(C)C(N1CCN(C)CC1)O2)S(=O)(=O)O |
| InChI | InChI=1S/C17H26N2O4S/c1-12(24(20,21)22)13-5-6-15-14(11-13)17(2,3)16(23-15)19-9-7-18(4)8-10-19/h5-6,11-12,16H,7-10H2,1-4H3,(H,20,21,22) |
| InChIKey | LPCROSMTGGZNBW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid?
The IUPAC name of 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid (CID 150976053) is 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid.
What is the SMILES notation for 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid?
The canonical SMILES for 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid is CC(c1ccc2c(c1)C(C)(C)C(N1CCN(C)CC1)O2)S(=O)(=O)O.
What is the InChIKey of 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid?
The InChIKey is LPCROSMTGGZNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4S/c1-12(24(20,21)22)13-5-6-15-14(11-13)17(2,3)16(23-15)19-9-7-18(4)8-10-19/h5-6,11-12,16H,7-10H2,1-4H3,(H,20,21,22).
What are the key properties of 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid?
1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid has a molecular weight of 354.47 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,3-dimethyl-2-(4-methylpiperazin-1-yl)-2H-1-benzofuran-5-yl]ethanesulfonic acid is sourced from PubChem (CID 150976053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).