About 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide
4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide (PubChem CID 150978973) has the molecular formula C27H21N3O3
and a molecular weight of 435.48 g/mol. Its IUPAC name is 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide.
Molecular Properties
| Compound Name | 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide |
| PubChem CID | 150978973 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc(-c3ccc(C(N)=O)cc3)cc(-c3ccc(C(N)=O)cc3)c2)cc1 |
| InChI | InChI=1S/C27H21N3O3/c28-25(31)19-7-1-16(2-8-19)22-13-23(17-3-9-20(10-4-17)26(29)32)15-24(14-22)18-5-11-21(12-6-18)27(30)33/h1-15H,(H2,28,31)(H2,29,32)(H2,30,33) |
| InChIKey | LPRNZGRCFFMMSK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide?
The IUPAC name of 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide (CID 150978973) is 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide.
What is the SMILES notation for 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide?
The canonical SMILES for 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide is NC(=O)c1ccc(-c2cc(-c3ccc(C(N)=O)cc3)cc(-c3ccc(C(N)=O)cc3)c2)cc1.
What is the InChIKey of 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide?
The InChIKey is LPRNZGRCFFMMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21N3O3/c28-25(31)19-7-1-16(2-8-19)22-13-23(17-3-9-20(10-4-17)26(29)32)15-24(14-22)18-5-11-21(12-6-18)27(30)33/h1-15H,(H2,28,31)(H2,29,32)(H2,30,33).
What are the key properties of 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide?
4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide has a molecular weight of 435.48 g/mol, XLogP of 3.98, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-bis(4-carbamoylphenyl)phenyl]benzamide is sourced from PubChem (CID 150978973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).