About tetrabutylstannane
tetrabutylstannane (PubChem CID 15098) has the molecular formula C16H36Sn
and a molecular weight of 347.18 g/mol. Its IUPAC name is tetrabutylstannane.
Molecular Properties
| Compound Name | tetrabutylstannane |
| PubChem CID | 15098 |
| Molecular Formula | C16H36Sn |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | tetrabutylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/4C4H9.Sn/c4*1-3-4-2;/h4*1,3-4H2,2H3; |
| InChIKey | AFCAKJKUYFLYFK-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetrabutylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylstannane?
The IUPAC name of tetrabutylstannane (CID 15098) is tetrabutylstannane.
What is the SMILES notation for tetrabutylstannane?
The canonical SMILES for tetrabutylstannane is CCCC[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of tetrabutylstannane?
The InChIKey is AFCAKJKUYFLYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/4C4H9.Sn/c4*1-3-4-2;/h4*1,3-4H2,2H3;.
What are the key properties of tetrabutylstannane?
tetrabutylstannane has a molecular weight of 347.18 g/mol, XLogP of 6.64, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylstannane is sourced from PubChem (CID 15098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).