About methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate
methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate (PubChem CID 150983150) has the molecular formula C18H19F2N3O3
and a molecular weight of 363.36 g/mol. Its IUPAC name is methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate |
| PubChem CID | 150983150 |
| Molecular Formula | C18H19F2N3O3 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(N2CCC(Oc3ccc(F)cc3F)CC2)c(N)cn1 |
| InChI | InChI=1S/C18H19F2N3O3/c1-25-18(24)15-9-16(14(21)10-22-15)23-6-4-12(5-7-23)26-17-3-2-11(19)8-13(17)20/h2-3,8-10,12H,4-7,21H2,1H3 |
| InChIKey | LQNCEYYHBVIKOR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate?
The IUPAC name of methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate (CID 150983150) is methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate?
The canonical SMILES for methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate is COC(=O)c1cc(N2CCC(Oc3ccc(F)cc3F)CC2)c(N)cn1.
What is the InChIKey of methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate?
The InChIKey is LQNCEYYHBVIKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2N3O3/c1-25-18(24)15-9-16(14(21)10-22-15)23-6-4-12(5-7-23)26-17-3-2-11(19)8-13(17)20/h2-3,8-10,12H,4-7,21H2,1H3.
What are the key properties of methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate?
methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate has a molecular weight of 363.36 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-4-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyridine-2-carboxylate is sourced from PubChem (CID 150983150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).