C23H44O3Si — CID 15098340
(1S,3aS,4S,7aS)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 15098340) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is (1S,3aS,4S,7aS)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | (1S,3aS,4S,7aS)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 15098340 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | (1S,3aS,4S,7aS)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | CC(C)(C)O[C@H]1CC[C@H]2[C@H](CCCO[Si](C)(C)C(C)(C)C)C(=O)CC[C@]12C |
| InChI | InChI=1S/C23H44O3Si/c1-21(2,3)26-20-13-12-18-17(19(24)14-15-23(18,20)7)11-10-16-25-27(8,9)22(4,5)6/h17-18,20H,10-16H2,1-9H3/t17-,18-,20-,23-/m0/s1 |
| InChIKey | VMVPSDNZANNKJU-JPPTWICTSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|