C29H28BClF3NO5 — CID 150984964
6-[[(1S)-4-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2-methoxy-5-(trifluoromethyl)pyridine-3-carbaldehyde (PubChem CID 150984964) has the molecular formula C29H28BClF3NO5 and a molecular weight of 573.80 g/mol. Its IUPAC name is 6-[[(1S)-4-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2-methoxy-5-(trifluoromethyl)pyridine-3-carbaldehyde.
| Compound Name | 6-[[(1S)-4-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2-methoxy-5-(trifluoromethyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 150984964 |
| Molecular Formula | C29H28BClF3NO5 |
| Molecular Weight | 573.80 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 6-[[(1S)-4-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2-methoxy-5-(trifluoromethyl)pyridine-3-carbaldehyde |
| SMILES | COc1nc(O[C@H]2CCc3c(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4Cl)cccc32)c(C(F)(F)F)cc1C=O |
| InChI | InChI=1S/C29H28BClF3NO5/c1-27(2)28(3,4)40-30(39-27)22-11-7-10-20(24(22)31)17-8-6-9-19-18(17)12-13-23(19)38-26-21(29(32,33)34)14-16(15-36)25(35-26)37-5/h6-11,14-15,23H,12-13H2,1-5H3/t23-/m0/s1 |
| InChIKey | LQWSODCVRVPSSI-QHCPKHFHSA-N |
| XLogP | 6.61 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.80 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|