C15H24O2 — CID 15098628
(1S,3R,8S,9R,11S)-3,7,7,11-tetramethyl-2,10-dioxatetracyclo[6.5.0.01,3.09,11]tridecane (PubChem CID 15098628) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1S,3R,8S,9R,11S)-3,7,7,11-tetramethyl-2,10-dioxatetracyclo[6.5.0.01,3.09,11]tridecane.
| Compound Name | (1S,3R,8S,9R,11S)-3,7,7,11-tetramethyl-2,10-dioxatetracyclo[6.5.0.01,3.09,11]tridecane |
|---|---|
| PubChem CID | 15098628 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,3R,8S,9R,11S)-3,7,7,11-tetramethyl-2,10-dioxatetracyclo[6.5.0.01,3.09,11]tridecane |
| SMILES | CC1(C)CCC[C@@]2(C)O[C@]23CC[C@]2(C)O[C@@H]2[C@H]13 |
| InChI | InChI=1S/C15H24O2/c1-12(2)6-5-7-14(4)15(17-14)9-8-13(3)11(16-13)10(12)15/h10-11H,5-9H2,1-4H3/t10-,11-,13+,14-,15+/m1/s1 |
| InChIKey | SHSIGPVOOLJSLS-NXRJPMIISA-N |
| XLogP | 3.29 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|