C26H40O7 — CID 15098711
methyl (1R,4aR,4bS,7R,8S,8aR,10aR)-8-acetyloxy-7-[(3-hydroxy-5-oxooxolan-3-yl)methyl]-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate (PubChem CID 15098711) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is methyl (1R,4aR,4bS,7R,8S,8aR,10aR)-8-acetyloxy-7-[(3-hydroxy-5-oxooxolan-3-yl)methyl]-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aR,4bS,7R,8S,8aR,10aR)-8-acetyloxy-7-[(3-hydroxy-5-oxooxolan-3-yl)methyl]-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 15098711 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | methyl (1R,4aR,4bS,7R,8S,8aR,10aR)-8-acetyloxy-7-[(3-hydroxy-5-oxooxolan-3-yl)methyl]-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@H]1CC[C@H]1[C@H](OC(C)=O)[C@@](C)(CC3(O)COC(=O)C3)CC[C@@H]12 |
| InChI | InChI=1S/C26H40O7/c1-16(27)33-21-17-7-8-19-24(3,10-6-11-25(19,4)22(29)31-5)18(17)9-12-23(21,2)14-26(30)13-20(28)32-15-26/h17-19,21,30H,6-15H2,1-5H3/t17-,18+,19-,21+,23-,24-,25-,26?/m1/s1 |
| InChIKey | OTKKBUVQOUXILR-AKKXPESVSA-N |
| XLogP | 3.80 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|