About N,N-diethyl-7,7-bis(phenylsilyl)heptanamide
N,N-diethyl-7,7-bis(phenylsilyl)heptanamide (PubChem CID 150989584) has the molecular formula C23H35NOSi2
and a molecular weight of 397.71 g/mol. Its IUPAC name is N,N-diethyl-7,7-bis(phenylsilyl)heptanamide.
Molecular Properties
| Compound Name | N,N-diethyl-7,7-bis(phenylsilyl)heptanamide |
| PubChem CID | 150989584 |
| Molecular Formula | C23H35NOSi2 |
| Molecular Weight | 397.71 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N,N-diethyl-7,7-bis(phenylsilyl)heptanamide |
| SMILES | CCN(CC)C(=O)CCCCCC([SiH2]c1ccccc1)[SiH2]c1ccccc1 |
| InChI | InChI=1S/C23H35NOSi2/c1-3-24(4-2)22(25)18-12-7-13-19-23(26-20-14-8-5-9-15-20)27-21-16-10-6-11-17-21/h5-6,8-11,14-17,23H,3-4,7,12-13,18-19,26-27H2,1-2H3 |
| InChIKey | LRVHQIUWVMAUKE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.71 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-7,7-bis(phenylsilyl)heptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-7,7-bis(phenylsilyl)heptanamide?
The IUPAC name of N,N-diethyl-7,7-bis(phenylsilyl)heptanamide (CID 150989584) is N,N-diethyl-7,7-bis(phenylsilyl)heptanamide.
What is the SMILES notation for N,N-diethyl-7,7-bis(phenylsilyl)heptanamide?
The canonical SMILES for N,N-diethyl-7,7-bis(phenylsilyl)heptanamide is CCN(CC)C(=O)CCCCCC([SiH2]c1ccccc1)[SiH2]c1ccccc1.
What is the InChIKey of N,N-diethyl-7,7-bis(phenylsilyl)heptanamide?
The InChIKey is LRVHQIUWVMAUKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35NOSi2/c1-3-24(4-2)22(25)18-12-7-13-19-23(26-20-14-8-5-9-15-20)27-21-16-10-6-11-17-21/h5-6,8-11,14-17,23H,3-4,7,12-13,18-19,26-27H2,1-2H3.
What are the key properties of N,N-diethyl-7,7-bis(phenylsilyl)heptanamide?
N,N-diethyl-7,7-bis(phenylsilyl)heptanamide has a molecular weight of 397.71 g/mol, XLogP of 2.54, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-7,7-bis(phenylsilyl)heptanamide is sourced from PubChem (CID 150989584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).