C7H14N4O2 — CID 150991312
4-[3-(dimethylamino)propyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 150991312) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[3-(dimethylamino)propyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 150991312 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 4-[3-(dimethylamino)propyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | CN(C)CCCn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C7H14N4O2/c1-10(2)4-3-5-11-6(12)8-9-7(11)13/h3-5H2,1-2H3,(H,8,12)(H,9,13) |
| InChIKey | LSEFLWWBGHGNQJ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 73.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |