C33H34O4 — CID 15099132
[(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] (E)-3,5-dioxo-7-phenylhept-6-enoate (PubChem CID 15099132) has the molecular formula C33H34O4 and a molecular weight of 494.63 g/mol. Its IUPAC name is [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] (E)-3,5-dioxo-7-phenylhept-6-enoate.
| Compound Name | [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] (E)-3,5-dioxo-7-phenylhept-6-enoate |
|---|---|
| PubChem CID | 15099132 |
| Molecular Formula | C33H34O4 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] (E)-3,5-dioxo-7-phenylhept-6-enoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](c1cccc3ccccc13)[C@H]2OC(=O)CC(=O)CC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C33H34O4/c1-32(2)28-18-19-33(32,3)30(27-15-9-13-23-12-7-8-14-26(23)27)31(28)37-29(36)21-25(35)20-24(34)17-16-22-10-5-4-6-11-22/h4-17,28,30-31H,18-21H2,1-3H3/b17-16+/t28-,30-,31-,33+/m0/s1 |
| InChIKey | IZSGWACZVOMIDB-WTJJUIJASA-N |
| XLogP | 6.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|