About 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one
9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one (PubChem CID 15099287) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one.
Molecular Properties
| Compound Name | 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one |
| PubChem CID | 15099287 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one |
| SMILES | CCn1c2c(c(=O)c3ccccc31)C(O)CO2 |
| InChI | InChI=1S/C13H13NO3/c1-2-14-9-6-4-3-5-8(9)12(16)11-10(15)7-17-13(11)14/h3-6,10,15H,2,7H2,1H3 |
| InChIKey | SHRQHKFHCUNBSA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one?
The IUPAC name of 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one (CID 15099287) is 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one.
What is the SMILES notation for 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one?
The canonical SMILES for 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one is CCn1c2c(c(=O)c3ccccc31)C(O)CO2.
What is the InChIKey of 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one?
The InChIKey is SHRQHKFHCUNBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-2-14-9-6-4-3-5-8(9)12(16)11-10(15)7-17-13(11)14/h3-6,10,15H,2,7H2,1H3.
What are the key properties of 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one?
9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one has a molecular weight of 231.25 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one is sourced from PubChem (CID 15099287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).