C13H13NO3 — CID 15099287
9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one (PubChem CID 15099287) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one.
| Compound Name | 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one |
|---|---|
| PubChem CID | 15099287 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 9-ethyl-3-hydroxy-2,3-dihydrofuro[2,3-b]quinolin-4-one |
| SMILES | CCn1c2c(c(=O)c3ccccc31)C(O)CO2 |
| InChI | InChI=1S/C13H13NO3/c1-2-14-9-6-4-3-5-8(9)12(16)11-10(15)7-17-13(11)14/h3-6,10,15H,2,7H2,1H3 |
| InChIKey | SHRQHKFHCUNBSA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |