C23H29N7O2 — CID 150994662
tert-butyl N-[(5R)-2-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]carbamate (PubChem CID 150994662) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is tert-butyl N-[(5R)-2-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5R)-2-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]carbamate |
|---|---|
| PubChem CID | 150994662 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | tert-butyl N-[(5R)-2-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]carbamate |
| SMILES | Cn1cc(Nc2ncnc(-c3ccc4c(c3)CCCC[C@H]4NC(=O)OC(C)(C)C)n2)cn1 |
| InChI | InChI=1S/C23H29N7O2/c1-23(2,3)32-22(31)28-19-8-6-5-7-15-11-16(9-10-18(15)19)20-24-14-25-21(29-20)27-17-12-26-30(4)13-17/h9-14,19H,5-8H2,1-4H3,(H,28,31)(H,24,25,27,29)/t19-/m1/s1 |
| InChIKey | LSVLUJJTZLKGBW-LJQANCHMSA-N |
| XLogP | 4.31 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |