About 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate
2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate (PubChem CID 150997430) has the molecular formula C8H7F2N2O2-
and a molecular weight of 201.15 g/mol. Its IUPAC name is 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate |
| PubChem CID | 150997430 |
| Molecular Formula | C8H7F2N2O2- |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate |
| SMILES | CCc1cnc(C(F)(F)C(=O)[O-])nc1 |
| InChI | InChI=1S/C8H8F2N2O2/c1-2-5-3-11-6(12-4-5)8(9,10)7(13)14/h3-4H,2H2,1H3,(H,13,14)/p-1 |
| InChIKey | LTJUXRZANFUNDY-UHFFFAOYSA-M |
| XLogP | -0.12 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate?
The IUPAC name of 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate (CID 150997430) is 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate.
What is the SMILES notation for 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate?
The canonical SMILES for 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate is CCc1cnc(C(F)(F)C(=O)[O-])nc1.
What is the InChIKey of 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate?
The InChIKey is LTJUXRZANFUNDY-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8F2N2O2/c1-2-5-3-11-6(12-4-5)8(9,10)7(13)14/h3-4H,2H2,1H3,(H,13,14)/p-1.
What are the key properties of 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate?
2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate has a molecular weight of 201.15 g/mol, XLogP of -0.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethylpyrimidin-2-yl)-2,2-difluoroacetate is sourced from PubChem (CID 150997430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).