About N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide
N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide (PubChem CID 151002740) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide.
Molecular Properties
| Compound Name | N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide |
| PubChem CID | 151002740 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide |
| SMILES | C=C(C)C(=O)N(O)C(=O)CCC(N)=O |
| InChI | InChI=1S/C8H12N2O4/c1-5(2)8(13)10(14)7(12)4-3-6(9)11/h14H,1,3-4H2,2H3,(H2,9,11) |
| InChIKey | LULLKKZMFAYLNI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide?
The IUPAC name of N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide (CID 151002740) is N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide.
What is the SMILES notation for N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide?
The canonical SMILES for N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide is C=C(C)C(=O)N(O)C(=O)CCC(N)=O.
What is the InChIKey of N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide?
The InChIKey is LULLKKZMFAYLNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-5(2)8(13)10(14)7(12)4-3-6(9)11/h14H,1,3-4H2,2H3,(H2,9,11).
What are the key properties of N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide?
N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide has a molecular weight of 200.19 g/mol, XLogP of -0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-N'-(2-methylprop-2-enoyl)butanediamide is sourced from PubChem (CID 151002740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).