C21H19N5O7S2 — CID 15100515
(6R,7R)-3-[(4-acetylphenoxy)methyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 15100515) has the molecular formula C21H19N5O7S2 and a molecular weight of 517.55 g/mol. Its IUPAC name is (6R,7R)-3-[(4-acetylphenoxy)methyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-[(4-acetylphenoxy)methyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 15100515 |
| Molecular Formula | C21H19N5O7S2 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | (6R,7R)-3-[(4-acetylphenoxy)methyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)c1ccc(OCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)/C(=N\O)c4csc(N)n4)[C@H]3SC2)cc1 |
| InChI | InChI=1S/C21H19N5O7S2/c1-9(27)10-2-4-12(5-3-10)33-6-11-7-34-19-15(18(29)26(19)16(11)20(30)31)24-17(28)14(25-32)13-8-35-21(22)23-13/h2-5,8,15,19,32H,6-7H2,1H3,(H2,22,23)(H,24,28)(H,30,31)/b25-14-/t15-,19-/m1/s1 |
| InChIKey | LGJARFZSUTYTRM-SAKAIADUSA-N |
| XLogP | 0.92 |
| TPSA | 184.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|