C29H32FN3O2Si — CID 151005541
3-[N-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)phenyl]-C-methylcarbonimidoyl]-5-(2-fluoro-6-methoxyphenyl)-1H-indol-2-ol (PubChem CID 151005541) has the molecular formula C29H32FN3O2Si and a molecular weight of 501.68 g/mol. Its IUPAC name is 3-[N-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)phenyl]-C-methylcarbonimidoyl]-5-(2-fluoro-6-methoxyphenyl)-1H-indol-2-ol.
| Compound Name | 3-[N-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)phenyl]-C-methylcarbonimidoyl]-5-(2-fluoro-6-methoxyphenyl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 151005541 |
| Molecular Formula | C29H32FN3O2Si |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 3-[N-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)phenyl]-C-methylcarbonimidoyl]-5-(2-fluoro-6-methoxyphenyl)-1H-indol-2-ol |
| SMILES | COc1cccc(F)c1-c1ccc2[nH]c(O)c(/C(C)=N/c3ccc(N4CC[Si](C)(C)CC4)cc3)c2c1 |
| InChI | InChI=1S/C29H32FN3O2Si/c1-19(31-21-9-11-22(12-10-21)33-14-16-36(3,4)17-15-33)27-23-18-20(8-13-25(23)32-29(27)34)28-24(30)6-5-7-26(28)35-2/h5-13,18,32,34H,14-17H2,1-4H3/b31-19+ |
| InChIKey | YUOJFADWKWHFDJ-ZCTHSVRISA-N |
| XLogP | 7.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|