C10H4O10 — CID 151006147
(5Z,12Z)-1,3,8,10-tetraoxacyclotetradeca-5,12-diene-2,4,7,9,11,14-hexone (PubChem CID 151006147) has the molecular formula C10H4O10 and a molecular weight of 284.13 g/mol. Its IUPAC name is (5Z,12Z)-1,3,8,10-tetraoxacyclotetradeca-5,12-diene-2,4,7,9,11,14-hexone.
| Compound Name | (5Z,12Z)-1,3,8,10-tetraoxacyclotetradeca-5,12-diene-2,4,7,9,11,14-hexone |
|---|---|
| PubChem CID | 151006147 |
| Molecular Formula | C10H4O10 |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | (5Z,12Z)-1,3,8,10-tetraoxacyclotetradeca-5,12-diene-2,4,7,9,11,14-hexone |
| SMILES | O=C1/C=C\C(=O)OC(=O)OC(=O)/C=C\C(=O)OC(=O)O1 |
| InChI | InChI=1S/C10H4O10/c11-5-1-2-6(12)18-10(16)20-8(14)4-3-7(13)19-9(15)17-5/h1-4H/b2-1-,4-3- |
| InChIKey | LVCUTRXOBVESBQ-LOKDLIDFSA-N |
| XLogP | -0.47 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|