C14H13F17O4 — CID 151006815
5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2,2-bis(hydroxymethyl)dodecane-1,3-diol (PubChem CID 151006815) has the molecular formula C14H13F17O4 and a molecular weight of 568.22 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2,2-bis(hydroxymethyl)dodecane-1,3-diol.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2,2-bis(hydroxymethyl)dodecane-1,3-diol |
|---|---|
| PubChem CID | 151006815 |
| Molecular Formula | C14H13F17O4 |
| Molecular Weight | 568.22 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2,2-bis(hydroxymethyl)dodecane-1,3-diol |
| SMILES | OCC(CO)(CO)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F17O4/c15-7(16,1-5(35)6(2-32,3-33)4-34)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h5,32-35H,1-4H2 |
| InChIKey | LVGJSHXTJQSDKQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|