C21H17F4N3O — CID 151009318
5-[4-cyclobutyl-2-fluoro-3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyridin-2-amine (PubChem CID 151009318) has the molecular formula C21H17F4N3O and a molecular weight of 403.38 g/mol. Its IUPAC name is 5-[4-cyclobutyl-2-fluoro-3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyridin-2-amine.
| Compound Name | 5-[4-cyclobutyl-2-fluoro-3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 151009318 |
| Molecular Formula | C21H17F4N3O |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 5-[4-cyclobutyl-2-fluoro-3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2ccc(C3CCC3)c(Oc3ncccc3C(F)(F)F)c2F)cn1 |
| InChI | InChI=1S/C21H17F4N3O/c22-18-14(13-6-9-17(26)28-11-13)7-8-15(12-3-1-4-12)19(18)29-20-16(21(23,24)25)5-2-10-27-20/h2,5-12H,1,3-4H2,(H2,26,28) |
| InChIKey | LVTGPKIALYJYKM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |