2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid

C10H16O4 — CID 15101121

IUPAC2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid
SMILESO=C(O)CC1CCC2(CC1)OCCO2
InChIInChI=1S/C10H16O4/c11-9(12)7-8-1-3-10(4-2-8)13-5-6-14-10/h8H,1-7H2,(H,11,12)
InChIKeyRDZCSTLPRXANJV-UHFFFAOYSA-N
MW200.23 g/mol
LogP1.39
Rot. Bonds2

About 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid

2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid (PubChem CID 15101121) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid.

Molecular Properties

Compound Name2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid
PubChem CID15101121
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid
SMILESO=C(O)CC1CCC2(CC1)OCCO2
InChIInChI=1S/C10H16O4/c11-9(12)7-8-1-3-10(4-2-8)13-5-6-14-10/h8H,1-7H2,(H,11,12)
InChIKeyRDZCSTLPRXANJV-UHFFFAOYSA-N
XLogP1.39
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid?
The IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid (CID 15101121) is 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid.
What is the SMILES notation for 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid?
The canonical SMILES for 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid is O=C(O)CC1CCC2(CC1)OCCO2.
What is the InChIKey of 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid?
The InChIKey is RDZCSTLPRXANJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c11-9(12)7-8-1-3-10(4-2-8)13-5-6-14-10/h8H,1-7H2,(H,11,12).
What are the key properties of 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid?
2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid has a molecular weight of 200.23 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxaspiro[4.5]decan-8-yl)acetic acid is sourced from PubChem (CID 15101121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).