About 5-nitro-3H-1,3-thiazole-2,2-diamine
5-nitro-3H-1,3-thiazole-2,2-diamine (PubChem CID 151012023) has the molecular formula C3H6N4O2S
and a molecular weight of 162.17 g/mol. Its IUPAC name is 5-nitro-3H-1,3-thiazole-2,2-diamine.
Molecular Properties
| Compound Name | 5-nitro-3H-1,3-thiazole-2,2-diamine |
| PubChem CID | 151012023 |
| Molecular Formula | C3H6N4O2S |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 5-nitro-3H-1,3-thiazole-2,2-diamine |
| SMILES | NC1(N)NC=C([N+](=O)[O-])S1 |
| InChI | InChI=1S/C3H6N4O2S/c4-3(5)6-1-2(10-3)7(8)9/h1,6H,4-5H2 |
| InChIKey | LWHKDLWQSAVPKB-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-3H-1,3-thiazole-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-3H-1,3-thiazole-2,2-diamine?
The IUPAC name of 5-nitro-3H-1,3-thiazole-2,2-diamine (CID 151012023) is 5-nitro-3H-1,3-thiazole-2,2-diamine.
What is the SMILES notation for 5-nitro-3H-1,3-thiazole-2,2-diamine?
The canonical SMILES for 5-nitro-3H-1,3-thiazole-2,2-diamine is NC1(N)NC=C([N+](=O)[O-])S1.
What is the InChIKey of 5-nitro-3H-1,3-thiazole-2,2-diamine?
The InChIKey is LWHKDLWQSAVPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4O2S/c4-3(5)6-1-2(10-3)7(8)9/h1,6H,4-5H2.
What are the key properties of 5-nitro-3H-1,3-thiazole-2,2-diamine?
5-nitro-3H-1,3-thiazole-2,2-diamine has a molecular weight of 162.17 g/mol, XLogP of -1.07, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-3H-1,3-thiazole-2,2-diamine is sourced from PubChem (CID 151012023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).