C16H23BN4O2 — CID 151012399
N-[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-3-yl]pyrimidin-4-amine (PubChem CID 151012399) has the molecular formula C16H23BN4O2 and a molecular weight of 314.20 g/mol. Its IUPAC name is N-[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-3-yl]pyrimidin-4-amine.
| Compound Name | N-[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 151012399 |
| Molecular Formula | C16H23BN4O2 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | N-[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-3-yl]pyrimidin-4-amine |
| SMILES | CN1C=C(B2OC(C)(C)C(C)(C)O2)C=C(Nc2ccncn2)C1 |
| InChI | InChI=1S/C16H23BN4O2/c1-15(2)16(3,4)23-17(22-15)12-8-13(10-21(5)9-12)20-14-6-7-18-11-19-14/h6-9,11H,10H2,1-5H3,(H,18,19,20) |
| InChIKey | LWJKAQINPBVCMG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|