C14H19Ru — CID 151014593
1-(2,4-dimethylpenta-1,3-dienyl)-5-ethylcyclopenta-1,3-diene;ruthenium(1+) (PubChem CID 151014593) has the molecular formula C14H19Ru and a molecular weight of 288.38 g/mol. Its IUPAC name is 1-(2,4-dimethylpenta-1,3-dienyl)-5-ethylcyclopenta-1,3-diene;ruthenium(1+).
| Compound Name | 1-(2,4-dimethylpenta-1,3-dienyl)-5-ethylcyclopenta-1,3-diene;ruthenium(1+) |
|---|---|
| PubChem CID | 151014593 |
| Molecular Formula | C14H19Ru |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-(2,4-dimethylpenta-1,3-dienyl)-5-ethylcyclopenta-1,3-diene;ruthenium(1+) |
| SMILES | CC[c-]1cccc1C=C(C)C=C(C)C.[Ru+] |
| InChI | InChI=1S/C14H19.Ru/c1-5-13-7-6-8-14(13)10-12(4)9-11(2)3;/h6-10H,5H2,1-4H3;/q-1;+1 |
| InChIKey | LWUOETMZXSGVJC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|