C4H2Br2F6O — CID 151015260
2-bromo-1-(2-bromo-1,1,2-trifluoroethoxy)-1,1,2-trifluoroethane (PubChem CID 151015260) has the molecular formula C4H2Br2F6O and a molecular weight of 339.86 g/mol. Its IUPAC name is 2-bromo-1-(2-bromo-1,1,2-trifluoroethoxy)-1,1,2-trifluoroethane.
| Compound Name | 2-bromo-1-(2-bromo-1,1,2-trifluoroethoxy)-1,1,2-trifluoroethane |
|---|---|
| PubChem CID | 151015260 |
| Molecular Formula | C4H2Br2F6O |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 337.84 |
| IUPAC Name | 2-bromo-1-(2-bromo-1,1,2-trifluoroethoxy)-1,1,2-trifluoroethane |
| SMILES | FC(Br)C(F)(F)OC(F)(F)C(F)Br |
| InChI | InChI=1S/C4H2Br2F6O/c5-1(7)3(9,10)13-4(11,12)2(6)8/h1-2H |
| InChIKey | LWYCSJWVGJVWNL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|