About dibutoxyphosphorylmethyl prop-2-enoate
dibutoxyphosphorylmethyl prop-2-enoate (PubChem CID 151016280) has the molecular formula C12H23O5P
and a molecular weight of 278.28 g/mol. Its IUPAC name is dibutoxyphosphorylmethyl prop-2-enoate.
Molecular Properties
| Compound Name | dibutoxyphosphorylmethyl prop-2-enoate |
| PubChem CID | 151016280 |
| Molecular Formula | C12H23O5P |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | dibutoxyphosphorylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCP(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C12H23O5P/c1-4-7-9-16-18(14,17-10-8-5-2)11-15-12(13)6-3/h6H,3-5,7-11H2,1-2H3 |
| InChIKey | LXDKCMURZIAOLP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibutoxyphosphorylmethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutoxyphosphorylmethyl prop-2-enoate?
The IUPAC name of dibutoxyphosphorylmethyl prop-2-enoate (CID 151016280) is dibutoxyphosphorylmethyl prop-2-enoate.
What is the SMILES notation for dibutoxyphosphorylmethyl prop-2-enoate?
The canonical SMILES for dibutoxyphosphorylmethyl prop-2-enoate is C=CC(=O)OCP(=O)(OCCCC)OCCCC.
What is the InChIKey of dibutoxyphosphorylmethyl prop-2-enoate?
The InChIKey is LXDKCMURZIAOLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23O5P/c1-4-7-9-16-18(14,17-10-8-5-2)11-15-12(13)6-3/h6H,3-5,7-11H2,1-2H3.
What are the key properties of dibutoxyphosphorylmethyl prop-2-enoate?
dibutoxyphosphorylmethyl prop-2-enoate has a molecular weight of 278.28 g/mol, XLogP of 3.50, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutoxyphosphorylmethyl prop-2-enoate is sourced from PubChem (CID 151016280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).