C12H12F3N3O2S — CID 1510182
1-ethyl-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-4-sulfonamide (PubChem CID 1510182) has the molecular formula C12H12F3N3O2S and a molecular weight of 319.30 g/mol. Its IUPAC name is 1-ethyl-N-[2-(trifluoromethyl)phenyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 1510182 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-ethyl-N-[2-(trifluoromethyl)phenyl]pyrazole-4-sulfonamide |
| SMILES | CCN1C=C(C=N1)S(=O)(=O)NC2=CC=CC=C2C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O2S/c1-2-18-8-9(7-16-18)21(19,20)17-11-6-4-3-5-10(11)12(13,14)15/h3-8,17H,2H2,1H3 |
| InChIKey | DWTRUSBCOCKROA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 450 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |