About 1,4-diaminopyrimidin-2-one
1,4-diaminopyrimidin-2-one (PubChem CID 15101965) has the molecular formula C4H6N4O
and a molecular weight of 126.12 g/mol. Its IUPAC name is 1,4-diaminopyrimidin-2-one.
Molecular Properties
| Compound Name | 1,4-diaminopyrimidin-2-one |
| PubChem CID | 15101965 |
| Molecular Formula | C4H6N4O |
| Molecular Weight | 126.12 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | 1,4-diaminopyrimidin-2-one |
| SMILES | Nc1ccn(N)c(=O)n1 |
| InChI | InChI=1S/C4H6N4O/c5-3-1-2-8(6)4(9)7-3/h1-2H,6H2,(H2,5,7,9) |
| InChIKey | KDXVHZYQDLWWGJ-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.12 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-diaminopyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diaminopyrimidin-2-one?
The IUPAC name of 1,4-diaminopyrimidin-2-one (CID 15101965) is 1,4-diaminopyrimidin-2-one.
What is the SMILES notation for 1,4-diaminopyrimidin-2-one?
The canonical SMILES for 1,4-diaminopyrimidin-2-one is Nc1ccn(N)c(=O)n1.
What is the InChIKey of 1,4-diaminopyrimidin-2-one?
The InChIKey is KDXVHZYQDLWWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O/c5-3-1-2-8(6)4(9)7-3/h1-2H,6H2,(H2,5,7,9).
What are the key properties of 1,4-diaminopyrimidin-2-one?
1,4-diaminopyrimidin-2-one has a molecular weight of 126.12 g/mol, XLogP of -1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diaminopyrimidin-2-one is sourced from PubChem (CID 15101965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).