C20H30O6 — CID 15102236
(1S,2S,4S,7R,9R,13S,14R,15S,16S,17S)-4,16-dihydroxy-15-methoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecane-3,11-dione (PubChem CID 15102236) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is (1S,2S,4S,7R,9R,13S,14R,15S,16S,17S)-4,16-dihydroxy-15-methoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecane-3,11-dione.
| Compound Name | (1S,2S,4S,7R,9R,13S,14R,15S,16S,17S)-4,16-dihydroxy-15-methoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecane-3,11-dione |
|---|---|
| PubChem CID | 15102236 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (1S,2S,4S,7R,9R,13S,14R,15S,16S,17S)-4,16-dihydroxy-15-methoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecane-3,11-dione |
| SMILES | CO[C@H]1[C@H](C)[C@@H]2CC(=O)O[C@@H]3C[C@H]4CC[C@H](O)C(=O)[C@]4(C)[C@@H]([C@@H]1O)[C@@]32C |
| InChI | InChI=1S/C20H30O6/c1-9-11-8-14(22)26-13-7-10-5-6-12(21)18(24)19(10,2)17(20(11,13)3)15(23)16(9)25-4/h9-13,15-17,21,23H,5-8H2,1-4H3/t9-,10-,11+,12+,13-,15-,16+,17-,19+,20-/m1/s1 |
| InChIKey | WBJLMPUNBWTLAQ-NEANSWLKSA-N |
| XLogP | 1.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |