C12H23BN2O4 — CID 151023098
(3aR,4S,5S,6aR)-5-amino-4-(3-boronopropyl)-2-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 151023098) has the molecular formula C12H23BN2O4 and a molecular weight of 270.14 g/mol. Its IUPAC name is (3aR,4S,5S,6aR)-5-amino-4-(3-boronopropyl)-2-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,4S,5S,6aR)-5-amino-4-(3-boronopropyl)-2-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 151023098 |
| Molecular Formula | C12H23BN2O4 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (3aR,4S,5S,6aR)-5-amino-4-(3-boronopropyl)-2-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | CN1C[C@@H]2C[C@@](N)(C(=O)O)[C@@H](CCCB(O)O)[C@@H]2C1 |
| InChI | InChI=1S/C12H23BN2O4/c1-15-6-8-5-12(14,11(16)17)10(9(8)7-15)3-2-4-13(18)19/h8-10,18-19H,2-7,14H2,1H3,(H,16,17)/t8-,9+,10-,12-/m0/s1 |
| InChIKey | LYMIUTLVAAOMIF-WYFGTUCQSA-N |
| XLogP | -0.78 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|