About 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one
8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 15102596) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
Molecular Properties
| Compound Name | 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| PubChem CID | 15102596 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CCOC(C)OC12CCCN1C(=O)CC2 |
| InChI | InChI=1S/C11H19NO3/c1-3-14-9(2)15-11-6-4-8-12(11)10(13)5-7-11/h9H,3-8H2,1-2H3 |
| InChIKey | WOPZDEKOVJWRRT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The IUPAC name of 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (CID 15102596) is 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
What is the SMILES notation for 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The canonical SMILES for 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is CCOC(C)OC12CCCN1C(=O)CC2.
What is the InChIKey of 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The InChIKey is WOPZDEKOVJWRRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-3-14-9(2)15-11-6-4-8-12(11)10(13)5-7-11/h9H,3-8H2,1-2H3.
What are the key properties of 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one has a molecular weight of 213.28 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-ethoxyethoxy)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is sourced from PubChem (CID 15102596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).