C25H34FN5O2 — CID 151028159
2-[2-[1-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-methyl-2-piperazin-1-ylbenzimidazol-4-yl]oxyethylamino]ethanol (PubChem CID 151028159) has the molecular formula C25H34FN5O2 and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-[2-[1-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-methyl-2-piperazin-1-ylbenzimidazol-4-yl]oxyethylamino]ethanol.
| Compound Name | 2-[2-[1-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-methyl-2-piperazin-1-ylbenzimidazol-4-yl]oxyethylamino]ethanol |
|---|---|
| PubChem CID | 151028159 |
| Molecular Formula | C25H34FN5O2 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 2-[2-[1-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-methyl-2-piperazin-1-ylbenzimidazol-4-yl]oxyethylamino]ethanol |
| SMILES | Cc1cc(OCCNCCO)c2nc(N3CCNCC3)n(Cc3cc(C)c(F)c(C)c3)c2c1 |
| InChI | InChI=1S/C25H34FN5O2/c1-17-12-21-24(22(13-17)33-11-7-28-6-10-32)29-25(30-8-4-27-5-9-30)31(21)16-20-14-18(2)23(26)19(3)15-20/h12-15,27-28,32H,4-11,16H2,1-3H3 |
| InChIKey | LZMHQGVBHYPPHE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|