C9H14N2O — CID 151028511
[3,4-bis(aminomethyl)phenyl]methanol (PubChem CID 151028511) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is [3,4-bis(aminomethyl)phenyl]methanol.
| Compound Name | [3,4-bis(aminomethyl)phenyl]methanol |
|---|---|
| PubChem CID | 151028511 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | [3,4-bis(aminomethyl)phenyl]methanol |
| SMILES | NCc1ccc(CO)cc1CN |
| InChI | InChI=1S/C9H14N2O/c10-4-8-2-1-7(6-12)3-9(8)5-11/h1-3,12H,4-6,10-11H2 |
| InChIKey | LZOAZNCNQHUMSE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |