About 4-azido-1-phenylpyrazole
4-azido-1-phenylpyrazole (PubChem CID 151030073) has the molecular formula C9H7N5
and a molecular weight of 185.19 g/mol. Its IUPAC name is 4-azido-1-phenylpyrazole.
Molecular Properties
| Compound Name | 4-azido-1-phenylpyrazole |
| PubChem CID | 151030073 |
| Molecular Formula | C9H7N5 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4-azido-1-phenylpyrazole |
| SMILES | [N-]=[N+]=Nc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C9H7N5/c10-13-12-8-6-11-14(7-8)9-4-2-1-3-5-9/h1-7H |
| InChIKey | LZWGQCSDWDGBTD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-1-phenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-1-phenylpyrazole?
The IUPAC name of 4-azido-1-phenylpyrazole (CID 151030073) is 4-azido-1-phenylpyrazole.
What is the SMILES notation for 4-azido-1-phenylpyrazole?
The canonical SMILES for 4-azido-1-phenylpyrazole is [N-]=[N+]=Nc1cnn(-c2ccccc2)c1.
What is the InChIKey of 4-azido-1-phenylpyrazole?
The InChIKey is LZWGQCSDWDGBTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5/c10-13-12-8-6-11-14(7-8)9-4-2-1-3-5-9/h1-7H.
What are the key properties of 4-azido-1-phenylpyrazole?
4-azido-1-phenylpyrazole has a molecular weight of 185.19 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-1-phenylpyrazole is sourced from PubChem (CID 151030073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).