About 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine
2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine (PubChem CID 151032201) has the molecular formula C10H10BrN3
and a molecular weight of 252.12 g/mol. Its IUPAC name is 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine.
Molecular Properties
| Compound Name | 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine |
| PubChem CID | 151032201 |
| Molecular Formula | C10H10BrN3 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine |
| SMILES | CN(C)c1cc2cccnc2nc1Br |
| InChI | InChI=1S/C10H10BrN3/c1-14(2)8-6-7-4-3-5-12-10(7)13-9(8)11/h3-6H,1-2H3 |
| InChIKey | MAHNXGSEWWJVFC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine?
The IUPAC name of 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine (CID 151032201) is 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine.
What is the SMILES notation for 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine?
The canonical SMILES for 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine is CN(C)c1cc2cccnc2nc1Br.
What is the InChIKey of 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine?
The InChIKey is MAHNXGSEWWJVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3/c1-14(2)8-6-7-4-3-5-12-10(7)13-9(8)11/h3-6H,1-2H3.
What are the key properties of 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine?
2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine has a molecular weight of 252.12 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N-dimethyl-1,8-naphthyridin-3-amine is sourced from PubChem (CID 151032201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).