C9H14F3N3 — CID 151032650
2-N'-ethyl-3-(2,2,2-trifluoroethyl)-1H-pyridine-2,2-diamine (PubChem CID 151032650) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is 2-N'-ethyl-3-(2,2,2-trifluoroethyl)-1H-pyridine-2,2-diamine.
| Compound Name | 2-N'-ethyl-3-(2,2,2-trifluoroethyl)-1H-pyridine-2,2-diamine |
|---|---|
| PubChem CID | 151032650 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-N'-ethyl-3-(2,2,2-trifluoroethyl)-1H-pyridine-2,2-diamine |
| SMILES | CCNC1(N)NC=CC=C1CC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3/c1-2-14-9(13)7(4-3-5-15-9)6-8(10,11)12/h3-5,14-15H,2,6,13H2,1H3 |
| InChIKey | MAJVFBYSEVOBOT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|