About 2-boronodecanoic acid
2-boronodecanoic acid (PubChem CID 151032724) has the molecular formula C10H21BO4
and a molecular weight of 216.09 g/mol. Its IUPAC name is 2-boronodecanoic acid.
Molecular Properties
| Compound Name | 2-boronodecanoic acid |
| PubChem CID | 151032724 |
| Molecular Formula | C10H21BO4 |
| Molecular Weight | 216.09 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-boronodecanoic acid |
| SMILES | CCCCCCCCC(B(O)O)C(=O)O |
| InChI | InChI=1S/C10H21BO4/c1-2-3-4-5-6-7-8-9(10(12)13)11(14)15/h9,14-15H,2-8H2,1H3,(H,12,13) |
| InChIKey | MAKDUANCKGUJCP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-boronodecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-boronodecanoic acid?
The IUPAC name of 2-boronodecanoic acid (CID 151032724) is 2-boronodecanoic acid.
What is the SMILES notation for 2-boronodecanoic acid?
The canonical SMILES for 2-boronodecanoic acid is CCCCCCCCC(B(O)O)C(=O)O.
What is the InChIKey of 2-boronodecanoic acid?
The InChIKey is MAKDUANCKGUJCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21BO4/c1-2-3-4-5-6-7-8-9(10(12)13)11(14)15/h9,14-15H,2-8H2,1H3,(H,12,13).
What are the key properties of 2-boronodecanoic acid?
2-boronodecanoic acid has a molecular weight of 216.09 g/mol, XLogP of 1.66, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-boronodecanoic acid is sourced from PubChem (CID 151032724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).