C28H26N4O — CID 151035556
2-ethynyl-N-(3-methyl-4-phenoxyphenyl)-6-piperidin-3-ylquinazolin-4-amine (PubChem CID 151035556) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-ethynyl-N-(3-methyl-4-phenoxyphenyl)-6-piperidin-3-ylquinazolin-4-amine.
| Compound Name | 2-ethynyl-N-(3-methyl-4-phenoxyphenyl)-6-piperidin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 151035556 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-ethynyl-N-(3-methyl-4-phenoxyphenyl)-6-piperidin-3-ylquinazolin-4-amine |
| SMILES | C#Cc1nc(Nc2ccc(Oc3ccccc3)c(C)c2)c2cc(C3CCCNC3)ccc2n1 |
| InChI | InChI=1S/C28H26N4O/c1-3-27-31-25-13-11-20(21-8-7-15-29-18-21)17-24(25)28(32-27)30-22-12-14-26(19(2)16-22)33-23-9-5-4-6-10-23/h1,4-6,9-14,16-17,21,29H,7-8,15,18H2,2H3,(H,30,31,32) |
| InChIKey | MAZPELKUKGFLSG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|