About methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane
methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane (PubChem CID 15104012) has the molecular formula C13H17P
and a molecular weight of 204.25 g/mol. Its IUPAC name is methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane.
Molecular Properties
| Compound Name | methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane |
| PubChem CID | 15104012 |
| Molecular Formula | C13H17P |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane |
| SMILES | CC#CP(C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H17P/c1-6-7-14(5)13-11(3)8-10(2)9-12(13)4/h8-9H,1-5H3 |
| InChIKey | LJTPBJRFTLMPLA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane?
The IUPAC name of methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane (CID 15104012) is methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane.
What is the SMILES notation for methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane?
The canonical SMILES for methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane is CC#CP(C)c1c(C)cc(C)cc1C.
What is the InChIKey of methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane?
The InChIKey is LJTPBJRFTLMPLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17P/c1-6-7-14(5)13-11(3)8-10(2)9-12(13)4/h8-9H,1-5H3.
What are the key properties of methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane?
methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane has a molecular weight of 204.25 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-prop-1-ynyl-(2,4,6-trimethylphenyl)phosphane is sourced from PubChem (CID 15104012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).